C29H33O8P — CID 118885704
[(2R,3S,4S,5R,6R)-2-diphenoxyphosphoryloxy-6-ethyl-5-methyl-4-phenylmethoxyoxan-3-yl] acetate (PubChem CID 118885704) has the molecular formula C29H33O8P and a molecular weight of 540.55 g/mol. Its IUPAC name is [(2R,3S,4S,5R,6R)-2-diphenoxyphosphoryloxy-6-ethyl-5-methyl-4-phenylmethoxyoxan-3-yl] acetate.
| Compound Name | [(2R,3S,4S,5R,6R)-2-diphenoxyphosphoryloxy-6-ethyl-5-methyl-4-phenylmethoxyoxan-3-yl] acetate |
|---|---|
| PubChem CID | 118885704 |
| Molecular Formula | C29H33O8P |
| Molecular Weight | 540.55 g/mol |
| Exact Mass | 540.19 |
| IUPAC Name | [(2R,3S,4S,5R,6R)-2-diphenoxyphosphoryloxy-6-ethyl-5-methyl-4-phenylmethoxyoxan-3-yl] acetate |
| SMILES | CC[C@H]1O[C@H](OP(=O)(Oc2ccccc2)Oc2ccccc2)[C@@H](OC(C)=O)[C@@H](OCc2ccccc2)[C@@H]1C |
| InChI | InChI=1S/C29H33O8P/c1-4-26-21(2)27(32-20-23-14-8-5-9-15-23)28(33-22(3)30)29(34-26)37-38(31,35-24-16-10-6-11-17-24)36-25-18-12-7-13-19-25/h5-19,21,26-29H,4,20H2,1-3H3/t21-,26-,27+,28+,29-/m1/s1 |
| InChIKey | NYIJFMHAKHKKIU-LWSGVCGRSA-N |
| XLogP | 6.56 |
| TPSA | 89.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.55 |
| LogP ≤ 5 | 6.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|