C27H33O12P — CID 24858010
[(2R,3R,4S,5R,6S)-3,5-diacetyloxy-6-bis(phenylmethoxy)phosphoryloxy-4-methoxyoxan-2-yl]methyl acetate (PubChem CID 24858010) has the molecular formula C27H33O12P and a molecular weight of 580.52 g/mol. Its IUPAC name is [(2R,3R,4S,5R,6S)-3,5-diacetyloxy-6-bis(phenylmethoxy)phosphoryloxy-4-methoxyoxan-2-yl]methyl acetate.
| Compound Name | [(2R,3R,4S,5R,6S)-3,5-diacetyloxy-6-bis(phenylmethoxy)phosphoryloxy-4-methoxyoxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 24858010 |
| Molecular Formula | C27H33O12P |
| Molecular Weight | 580.52 g/mol |
| Exact Mass | 580.17 |
| IUPAC Name | [(2R,3R,4S,5R,6S)-3,5-diacetyloxy-6-bis(phenylmethoxy)phosphoryloxy-4-methoxyoxan-2-yl]methyl acetate |
| SMILES | CO[C@@H]1[C@@H](OC(C)=O)[C@H](OP(=O)(OCc2ccccc2)OCc2ccccc2)O[C@H](COC(C)=O)[C@H]1OC(C)=O |
| InChI | InChI=1S/C27H33O12P/c1-18(28)33-17-23-24(36-19(2)29)25(32-4)26(37-20(3)30)27(38-23)39-40(31,34-15-21-11-7-5-8-12-21)35-16-22-13-9-6-10-14-22/h5-14,23-27H,15-17H2,1-4H3/t23-,24-,25+,26-,27+/m1/s1 |
| InChIKey | BVNZCXWTIQXJEW-SEFGFODJSA-N |
| XLogP | 3.71 |
| TPSA | 142.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.52 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|