C28H33O13P — CID 71013931
methyl (2S,4R,5R)-3,4,5-triacetyloxy-6-[bis(phenylmethoxy)phosphoryloxymethyl]oxane-2-carboxylate (PubChem CID 71013931) has the molecular formula C28H33O13P and a molecular weight of 608.53 g/mol. Its IUPAC name is methyl (2S,4R,5R)-3,4,5-triacetyloxy-6-[bis(phenylmethoxy)phosphoryloxymethyl]oxane-2-carboxylate.
| Compound Name | methyl (2S,4R,5R)-3,4,5-triacetyloxy-6-[bis(phenylmethoxy)phosphoryloxymethyl]oxane-2-carboxylate |
|---|---|
| PubChem CID | 71013931 |
| Molecular Formula | C28H33O13P |
| Molecular Weight | 608.53 g/mol |
| Exact Mass | 608.17 |
| IUPAC Name | methyl (2S,4R,5R)-3,4,5-triacetyloxy-6-[bis(phenylmethoxy)phosphoryloxymethyl]oxane-2-carboxylate |
| SMILES | COC(=O)[C@H]1OC(COP(=O)(OCc2ccccc2)OCc2ccccc2)[C@@H](OC(C)=O)[C@@H](OC(C)=O)C1OC(C)=O |
| InChI | InChI=1S/C28H33O13P/c1-18(29)38-24-23(41-27(28(32)34-4)26(40-20(3)31)25(24)39-19(2)30)17-37-42(33,35-15-21-11-7-5-8-12-21)36-16-22-13-9-6-10-14-22/h5-14,23-27H,15-17H2,1-4H3/t23?,24-,25-,26?,27+/m1/s1 |
| InChIKey | NEIMXLCBOCKIBU-WTSBDUMSSA-N |
| XLogP | 3.28 |
| TPSA | 159.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 608.53 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|