C29H35O13P — CID 59197721
methyl 2-[(2S,4R,5S)-3,4,5-triacetyloxy-6-[bis(phenylmethoxy)phosphoryloxymethyl]oxan-2-yl]acetate (PubChem CID 59197721) has the molecular formula C29H35O13P and a molecular weight of 622.56 g/mol. Its IUPAC name is methyl 2-[(2S,4R,5S)-3,4,5-triacetyloxy-6-[bis(phenylmethoxy)phosphoryloxymethyl]oxan-2-yl]acetate.
| Compound Name | methyl 2-[(2S,4R,5S)-3,4,5-triacetyloxy-6-[bis(phenylmethoxy)phosphoryloxymethyl]oxan-2-yl]acetate |
|---|---|
| PubChem CID | 59197721 |
| Molecular Formula | C29H35O13P |
| Molecular Weight | 622.56 g/mol |
| Exact Mass | 622.18 |
| IUPAC Name | methyl 2-[(2S,4R,5S)-3,4,5-triacetyloxy-6-[bis(phenylmethoxy)phosphoryloxymethyl]oxan-2-yl]acetate |
| SMILES | COC(=O)C[C@@H]1OC(COP(=O)(OCc2ccccc2)OCc2ccccc2)[C@H](OC(C)=O)[C@H](OC(C)=O)C1OC(C)=O |
| InChI | InChI=1S/C29H35O13P/c1-19(30)39-27-24(15-26(33)35-4)42-25(28(40-20(2)31)29(27)41-21(3)32)18-38-43(34,36-16-22-11-7-5-8-12-22)37-17-23-13-9-6-10-14-23/h5-14,24-25,27-29H,15-18H2,1-4H3/t24-,25?,27?,28-,29+/m0/s1 |
| InChIKey | CZOOHZFHYSPUPN-OFASPCIFSA-N |
| XLogP | 3.67 |
| TPSA | 159.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 622.56 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|