C28H34O9 — CID 102315981
ethyl 2-[(2S,3S,4R,5S,6R)-4-acetyloxy-6-(acetyloxymethyl)-3,5-bis(phenylmethoxy)oxan-2-yl]acetate (PubChem CID 102315981) has the molecular formula C28H34O9 and a molecular weight of 514.57 g/mol. Its IUPAC name is ethyl 2-[(2S,3S,4R,5S,6R)-4-acetyloxy-6-(acetyloxymethyl)-3,5-bis(phenylmethoxy)oxan-2-yl]acetate.
| Compound Name | ethyl 2-[(2S,3S,4R,5S,6R)-4-acetyloxy-6-(acetyloxymethyl)-3,5-bis(phenylmethoxy)oxan-2-yl]acetate |
|---|---|
| PubChem CID | 102315981 |
| Molecular Formula | C28H34O9 |
| Molecular Weight | 514.57 g/mol |
| Exact Mass | 514.22 |
| IUPAC Name | ethyl 2-[(2S,3S,4R,5S,6R)-4-acetyloxy-6-(acetyloxymethyl)-3,5-bis(phenylmethoxy)oxan-2-yl]acetate |
| SMILES | CCOC(=O)C[C@@H]1O[C@H](COC(C)=O)[C@H](OCc2ccccc2)[C@H](OC(C)=O)[C@H]1OCc1ccccc1 |
| InChI | InChI=1S/C28H34O9/c1-4-32-25(31)15-23-26(34-16-21-11-7-5-8-12-21)28(36-20(3)30)27(24(37-23)18-33-19(2)29)35-17-22-13-9-6-10-14-22/h5-14,23-24,26-28H,4,15-18H2,1-3H3/t23-,24+,26-,27-,28+/m0/s1 |
| InChIKey | IBIMMSRZGOUZTK-AYASFNNFSA-N |
| XLogP | 3.37 |
| TPSA | 106.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.57 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|