C26H36O11 — CID 10744620
methyl 6-[(2S,3R,4S,5R,6R)-4,5-diacetyloxy-6-(acetyloxymethyl)-3-phenylmethoxyoxan-2-yl]oxyhexanoate (PubChem CID 10744620) has the molecular formula C26H36O11 and a molecular weight of 524.56 g/mol. Its IUPAC name is methyl 6-[(2S,3R,4S,5R,6R)-4,5-diacetyloxy-6-(acetyloxymethyl)-3-phenylmethoxyoxan-2-yl]oxyhexanoate.
| Compound Name | methyl 6-[(2S,3R,4S,5R,6R)-4,5-diacetyloxy-6-(acetyloxymethyl)-3-phenylmethoxyoxan-2-yl]oxyhexanoate |
|---|---|
| PubChem CID | 10744620 |
| Molecular Formula | C26H36O11 |
| Molecular Weight | 524.56 g/mol |
| Exact Mass | 524.23 |
| IUPAC Name | methyl 6-[(2S,3R,4S,5R,6R)-4,5-diacetyloxy-6-(acetyloxymethyl)-3-phenylmethoxyoxan-2-yl]oxyhexanoate |
| SMILES | COC(=O)CCCCCO[C@H]1O[C@H](COC(C)=O)[C@@H](OC(C)=O)[C@H](OC(C)=O)[C@H]1OCc1ccccc1 |
| InChI | InChI=1S/C26H36O11/c1-17(27)33-16-21-23(35-18(2)28)24(36-19(3)29)25(34-15-20-11-7-5-8-12-20)26(37-21)32-14-10-6-9-13-22(30)31-4/h5,7-8,11-12,21,23-26H,6,9-10,13-16H2,1-4H3/t21-,23-,24+,25-,26+/m1/s1 |
| InChIKey | UQUHPYCYEKMOJC-ZGLCYIBRSA-N |
| XLogP | 2.47 |
| TPSA | 132.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.56 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|