C28H30O13 — CID 163851383
methyl (2S,3S,4S,5R,6S)-3,4,5-triacetyloxy-6-(2-methoxy-4-phenylmethoxycarbonylphenoxy)oxane-2-carboxylate (PubChem CID 163851383) has the molecular formula C28H30O13 and a molecular weight of 574.54 g/mol. Its IUPAC name is methyl (2S,3S,4S,5R,6S)-3,4,5-triacetyloxy-6-(2-methoxy-4-phenylmethoxycarbonylphenoxy)oxane-2-carboxylate.
| Compound Name | methyl (2S,3S,4S,5R,6S)-3,4,5-triacetyloxy-6-(2-methoxy-4-phenylmethoxycarbonylphenoxy)oxane-2-carboxylate |
|---|---|
| PubChem CID | 163851383 |
| Molecular Formula | C28H30O13 |
| Molecular Weight | 574.54 g/mol |
| Exact Mass | 574.17 |
| IUPAC Name | methyl (2S,3S,4S,5R,6S)-3,4,5-triacetyloxy-6-(2-methoxy-4-phenylmethoxycarbonylphenoxy)oxane-2-carboxylate |
| SMILES | COC(=O)[C@H]1O[C@@H](Oc2ccc(C(=O)OCc3ccccc3)cc2OC)[C@H](OC(C)=O)[C@@H](OC(C)=O)[C@@H]1OC(C)=O |
| InChI | InChI=1S/C28H30O13/c1-15(29)37-22-23(38-16(2)30)25(39-17(3)31)28(41-24(22)27(33)35-5)40-20-12-11-19(13-21(20)34-4)26(32)36-14-18-9-7-6-8-10-18/h6-13,22-25,28H,14H2,1-5H3/t22-,23-,24-,25+,28+/m0/s1 |
| InChIKey | LUYYODVNWPGRDY-XOJGLMOTSA-N |
| XLogP | 2.12 |
| TPSA | 159.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.54 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|