C20H25NO11 — CID 138519498
methyl 3,4,5-triacetyloxy-6-[4-amino-2-(hydroxymethyl)phenoxy]oxane-2-carboxylate (PubChem CID 138519498) has the molecular formula C20H25NO11 and a molecular weight of 455.42 g/mol. Its IUPAC name is methyl 3,4,5-triacetyloxy-6-[4-amino-2-(hydroxymethyl)phenoxy]oxane-2-carboxylate.
| Compound Name | methyl 3,4,5-triacetyloxy-6-[4-amino-2-(hydroxymethyl)phenoxy]oxane-2-carboxylate |
|---|---|
| PubChem CID | 138519498 |
| Molecular Formula | C20H25NO11 |
| Molecular Weight | 455.42 g/mol |
| Exact Mass | 455.14 |
| IUPAC Name | methyl 3,4,5-triacetyloxy-6-[4-amino-2-(hydroxymethyl)phenoxy]oxane-2-carboxylate |
| SMILES | COC(=O)C1OC(Oc2ccc(N)cc2CO)C(OC(C)=O)C(OC(C)=O)C1OC(C)=O |
| InChI | InChI=1S/C20H25NO11/c1-9(23)28-15-16(29-10(2)24)18(30-11(3)25)20(32-17(15)19(26)27-4)31-14-6-5-13(21)7-12(14)8-22/h5-7,15-18,20,22H,8,21H2,1-4H3 |
| InChIKey | GOLHIYOQOLWPDC-UHFFFAOYSA-N |
| XLogP | -0.17 |
| TPSA | 169.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.42 |
| LogP ≤ 5 | -0.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|