C24H30N4O11 — CID 134350657
methyl (2S,3S,4S,5R,6S)-3,4,5-triacetyloxy-6-[2-[(3-azidopropylamino)methyl]-4-formylphenoxy]oxane-2-carboxylate (PubChem CID 134350657) has the molecular formula C24H30N4O11 and a molecular weight of 550.52 g/mol. Its IUPAC name is methyl (2S,3S,4S,5R,6S)-3,4,5-triacetyloxy-6-[2-[(3-azidopropylamino)methyl]-4-formylphenoxy]oxane-2-carboxylate.
| Compound Name | methyl (2S,3S,4S,5R,6S)-3,4,5-triacetyloxy-6-[2-[(3-azidopropylamino)methyl]-4-formylphenoxy]oxane-2-carboxylate |
|---|---|
| PubChem CID | 134350657 |
| Molecular Formula | C24H30N4O11 |
| Molecular Weight | 550.52 g/mol |
| Exact Mass | 550.19 |
| IUPAC Name | methyl (2S,3S,4S,5R,6S)-3,4,5-triacetyloxy-6-[2-[(3-azidopropylamino)methyl]-4-formylphenoxy]oxane-2-carboxylate |
| SMILES | COC(=O)[C@H]1O[C@@H](Oc2ccc(C=O)cc2CNCCCN=[N+]=[N-])[C@H](OC(C)=O)[C@@H](OC(C)=O)[C@@H]1OC(C)=O |
| InChI | InChI=1S/C24H30N4O11/c1-13(30)35-19-20(36-14(2)31)22(37-15(3)32)24(39-21(19)23(33)34-4)38-18-7-6-16(12-29)10-17(18)11-26-8-5-9-27-28-25/h6-7,10,12,19-22,24,26H,5,8-9,11H2,1-4H3/t19-,20-,21-,22+,24+/m0/s1 |
| InChIKey | JZAMWRRQTZEFJV-VZGLXOSZSA-N |
| XLogP | 1.36 |
| TPSA | 201.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.52 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'} |
|---|