C22H28N4O11 — CID 129180852
methyl (2S,3S,4R,5R,6S)-3,4-diacetyloxy-6-[2-(4-azidobutanoylamino)-4-(hydroxymethyl)phenoxy]-5-hydroxyoxane-2-carboxylate (PubChem CID 129180852) has the molecular formula C22H28N4O11 and a molecular weight of 524.48 g/mol. Its IUPAC name is methyl (2S,3S,4R,5R,6S)-3,4-diacetyloxy-6-[2-(4-azidobutanoylamino)-4-(hydroxymethyl)phenoxy]-5-hydroxyoxane-2-carboxylate.
| Compound Name | methyl (2S,3S,4R,5R,6S)-3,4-diacetyloxy-6-[2-(4-azidobutanoylamino)-4-(hydroxymethyl)phenoxy]-5-hydroxyoxane-2-carboxylate |
|---|---|
| PubChem CID | 129180852 |
| Molecular Formula | C22H28N4O11 |
| Molecular Weight | 524.48 g/mol |
| Exact Mass | 524.18 |
| IUPAC Name | methyl (2S,3S,4R,5R,6S)-3,4-diacetyloxy-6-[2-(4-azidobutanoylamino)-4-(hydroxymethyl)phenoxy]-5-hydroxyoxane-2-carboxylate |
| SMILES | COC(=O)[C@H]1O[C@@H](Oc2ccc(CO)cc2NC(=O)CCCN=[N+]=[N-])[C@H](O)[C@@H](OC(C)=O)[C@@H]1OC(C)=O |
| InChI | InChI=1S/C22H28N4O11/c1-11(28)34-18-17(31)22(37-20(21(32)33-3)19(18)35-12(2)29)36-15-7-6-13(10-27)9-14(15)25-16(30)5-4-8-24-26-23/h6-7,9,17-20,22,27,31H,4-5,8,10H2,1-3H3,(H,25,30)/t17-,18-,19+,20+,22-/m1/s1 |
| InChIKey | DHQUQSAPDNZNJT-JXDTVZCFSA-N |
| XLogP | 0.71 |
| TPSA | 215.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.48 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|