C17H22N4O8 — CID 159412807
6-[4-(4-azidobutanoylamino)-2-methylphenoxy]-3,4,5-trihydroxyoxane-2-carboxylic acid (PubChem CID 159412807) has the molecular formula C17H22N4O8 and a molecular weight of 410.38 g/mol. Its IUPAC name is 6-[4-(4-azidobutanoylamino)-2-methylphenoxy]-3,4,5-trihydroxyoxane-2-carboxylic acid.
| Compound Name | 6-[4-(4-azidobutanoylamino)-2-methylphenoxy]-3,4,5-trihydroxyoxane-2-carboxylic acid |
|---|---|
| PubChem CID | 159412807 |
| Molecular Formula | C17H22N4O8 |
| Molecular Weight | 410.38 g/mol |
| Exact Mass | 410.14 |
| IUPAC Name | 6-[4-(4-azidobutanoylamino)-2-methylphenoxy]-3,4,5-trihydroxyoxane-2-carboxylic acid |
| SMILES | Cc1cc(NC(=O)CCCN=[N+]=[N-])ccc1OC1OC(C(=O)O)C(O)C(O)C1O |
| InChI | InChI=1S/C17H22N4O8/c1-8-7-9(20-11(22)3-2-6-19-21-18)4-5-10(8)28-17-14(25)12(23)13(24)15(29-17)16(26)27/h4-5,7,12-15,17,23-25H,2-3,6H2,1H3,(H,20,22)(H,26,27) |
| InChIKey | MNXRSTSWCAZOTP-UHFFFAOYSA-N |
| XLogP | 0.30 |
| TPSA | 194.31 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.38 |
| LogP ≤ 5 | 0.30 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|