C24H30N4O12 — CID 129176071
methyl (2S,3S,4S,5R)-3,4,5-triacetyloxy-6-[2-(4-azidobutanoylamino)-4-(hydroxymethyl)phenoxy]oxane-2-carboxylate (PubChem CID 129176071) has the molecular formula C24H30N4O12 and a molecular weight of 566.52 g/mol. Its IUPAC name is methyl (2S,3S,4S,5R)-3,4,5-triacetyloxy-6-[2-(4-azidobutanoylamino)-4-(hydroxymethyl)phenoxy]oxane-2-carboxylate.
| Compound Name | methyl (2S,3S,4S,5R)-3,4,5-triacetyloxy-6-[2-(4-azidobutanoylamino)-4-(hydroxymethyl)phenoxy]oxane-2-carboxylate |
|---|---|
| PubChem CID | 129176071 |
| Molecular Formula | C24H30N4O12 |
| Molecular Weight | 566.52 g/mol |
| Exact Mass | 566.19 |
| IUPAC Name | methyl (2S,3S,4S,5R)-3,4,5-triacetyloxy-6-[2-(4-azidobutanoylamino)-4-(hydroxymethyl)phenoxy]oxane-2-carboxylate |
| SMILES | COC(=O)[C@H]1OC(Oc2ccc(CO)cc2NC(=O)CCCN=[N+]=[N-])[C@H](OC(C)=O)[C@@H](OC(C)=O)[C@@H]1OC(C)=O |
| InChI | InChI=1S/C24H30N4O12/c1-12(30)36-19-20(37-13(2)31)22(38-14(3)32)24(40-21(19)23(34)35-4)39-17-8-7-15(11-29)10-16(17)27-18(33)6-5-9-26-28-25/h7-8,10,19-22,24,29H,5-6,9,11H2,1-4H3,(H,27,33)/t19-,20-,21-,22+,24?/m0/s1 |
| InChIKey | WRKVFTSFZDFIDC-LBBBXPITSA-N |
| XLogP | 1.28 |
| TPSA | 221.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.52 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|