C24H29N3O13 — CID 121376243
methyl (2S,3S,4S,5R,6S)-3,4,5-triacetyloxy-6-[5-[2-(2-azidoethoxy)ethoxy]-2-formylphenoxy]oxane-2-carboxylate (PubChem CID 121376243) has the molecular formula C24H29N3O13 and a molecular weight of 567.50 g/mol. Its IUPAC name is methyl (2S,3S,4S,5R,6S)-3,4,5-triacetyloxy-6-[5-[2-(2-azidoethoxy)ethoxy]-2-formylphenoxy]oxane-2-carboxylate.
| Compound Name | methyl (2S,3S,4S,5R,6S)-3,4,5-triacetyloxy-6-[5-[2-(2-azidoethoxy)ethoxy]-2-formylphenoxy]oxane-2-carboxylate |
|---|---|
| PubChem CID | 121376243 |
| Molecular Formula | C24H29N3O13 |
| Molecular Weight | 567.50 g/mol |
| Exact Mass | 567.17 |
| IUPAC Name | methyl (2S,3S,4S,5R,6S)-3,4,5-triacetyloxy-6-[5-[2-(2-azidoethoxy)ethoxy]-2-formylphenoxy]oxane-2-carboxylate |
| SMILES | COC(=O)[C@H]1O[C@@H](Oc2cc(OCCOCCN=[N+]=[N-])ccc2C=O)[C@H](OC(C)=O)[C@@H](OC(C)=O)[C@@H]1OC(C)=O |
| InChI | InChI=1S/C24H29N3O13/c1-13(29)36-19-20(37-14(2)30)22(38-15(3)31)24(40-21(19)23(32)33-4)39-18-11-17(6-5-16(18)12-28)35-10-9-34-8-7-26-27-25/h5-6,11-12,19-22,24H,7-10H2,1-4H3/t19-,20-,21-,22+,24+/m0/s1 |
| InChIKey | BLXVJMRBSKRMLJ-VZGLXOSZSA-N |
| XLogP | 1.28 |
| TPSA | 207.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.50 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'} |
|---|