C20H21BrO11 — CID 121397933
methyl (2S,3S,4S,5R,6S)-3,4,5-triacetyloxy-6-(3-bromo-4-formylphenoxy)oxane-2-carboxylate (PubChem CID 121397933) has the molecular formula C20H21BrO11 and a molecular weight of 517.28 g/mol. Its IUPAC name is methyl (2S,3S,4S,5R,6S)-3,4,5-triacetyloxy-6-(3-bromo-4-formylphenoxy)oxane-2-carboxylate.
| Compound Name | methyl (2S,3S,4S,5R,6S)-3,4,5-triacetyloxy-6-(3-bromo-4-formylphenoxy)oxane-2-carboxylate |
|---|---|
| PubChem CID | 121397933 |
| Molecular Formula | C20H21BrO11 |
| Molecular Weight | 517.28 g/mol |
| Exact Mass | 516.03 |
| IUPAC Name | methyl (2S,3S,4S,5R,6S)-3,4,5-triacetyloxy-6-(3-bromo-4-formylphenoxy)oxane-2-carboxylate |
| SMILES | COC(=O)[C@H]1O[C@@H](Oc2ccc(C=O)c(Br)c2)[C@H](OC(C)=O)[C@@H](OC(C)=O)[C@@H]1OC(C)=O |
| InChI | InChI=1S/C20H21BrO11/c1-9(23)28-15-16(29-10(2)24)18(30-11(3)25)20(32-17(15)19(26)27-4)31-13-6-5-12(8-22)14(21)7-13/h5-8,15-18,20H,1-4H3/t15-,16-,17-,18+,20+/m0/s1 |
| InChIKey | OBDCPLVCYIOYLN-KVIJGQROSA-N |
| XLogP | 1.33 |
| TPSA | 140.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.28 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|