C19H24O10 — CID 121386857
methyl (2S,3S,4S,5R,6S)-4,5-diacetyloxy-6-[3-hydroxy-4-(hydroxymethyl)phenoxy]-3-methyloxane-2-carboxylate (PubChem CID 121386857) has the molecular formula C19H24O10 and a molecular weight of 412.39 g/mol. Its IUPAC name is methyl (2S,3S,4S,5R,6S)-4,5-diacetyloxy-6-[3-hydroxy-4-(hydroxymethyl)phenoxy]-3-methyloxane-2-carboxylate.
| Compound Name | methyl (2S,3S,4S,5R,6S)-4,5-diacetyloxy-6-[3-hydroxy-4-(hydroxymethyl)phenoxy]-3-methyloxane-2-carboxylate |
|---|---|
| PubChem CID | 121386857 |
| Molecular Formula | C19H24O10 |
| Molecular Weight | 412.39 g/mol |
| Exact Mass | 412.14 |
| IUPAC Name | methyl (2S,3S,4S,5R,6S)-4,5-diacetyloxy-6-[3-hydroxy-4-(hydroxymethyl)phenoxy]-3-methyloxane-2-carboxylate |
| SMILES | COC(=O)[C@H]1O[C@@H](Oc2ccc(CO)c(O)c2)[C@H](OC(C)=O)[C@@H](OC(C)=O)[C@@H]1C |
| InChI | InChI=1S/C19H24O10/c1-9-15(26-10(2)21)17(27-11(3)22)19(29-16(9)18(24)25-4)28-13-6-5-12(8-20)14(23)7-13/h5-7,9,15-17,19-20,23H,8H2,1-4H3/t9-,15-,16-,17+,19+/m0/s1 |
| InChIKey | WZVGJDFODLWRTO-HNYQSSBKSA-N |
| XLogP | 0.66 |
| TPSA | 137.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.39 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|