C18H21NO9 — CID 159961823
methyl (2S,3S,4S,5R,6S)-4,5-diacetyloxy-6-[(2-formyl-3-pyridinyl)oxy]-3-methyloxane-2-carboxylate (PubChem CID 159961823) has the molecular formula C18H21NO9 and a molecular weight of 395.36 g/mol. Its IUPAC name is methyl (2S,3S,4S,5R,6S)-4,5-diacetyloxy-6-[(2-formyl-3-pyridinyl)oxy]-3-methyloxane-2-carboxylate.
| Compound Name | methyl (2S,3S,4S,5R,6S)-4,5-diacetyloxy-6-[(2-formyl-3-pyridinyl)oxy]-3-methyloxane-2-carboxylate |
|---|---|
| PubChem CID | 159961823 |
| Molecular Formula | C18H21NO9 |
| Molecular Weight | 395.36 g/mol |
| Exact Mass | 395.12 |
| IUPAC Name | methyl (2S,3S,4S,5R,6S)-4,5-diacetyloxy-6-[(2-formyl-3-pyridinyl)oxy]-3-methyloxane-2-carboxylate |
| SMILES | COC(=O)[C@H]1O[C@@H](Oc2cccnc2C=O)[C@H](OC(C)=O)[C@@H](OC(C)=O)[C@@H]1C |
| InChI | InChI=1S/C18H21NO9/c1-9-14(25-10(2)21)16(26-11(3)22)18(28-15(9)17(23)24-4)27-13-6-5-7-19-12(13)8-20/h5-9,14-16,18H,1-4H3/t9-,14-,15-,16+,18+/m0/s1 |
| InChIKey | ODKVOMZQPPZLQW-DJWOZZDDSA-N |
| XLogP | 0.67 |
| TPSA | 127.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.36 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|