C18H24O7 — CID 164980192
methyl (2S,3S,4R,5R,6S)-3-acetyloxy-6-[4-(hydroxymethyl)phenoxy]-4,5-dimethyloxane-2-carboxylate (PubChem CID 164980192) has the molecular formula C18H24O7 and a molecular weight of 352.38 g/mol. Its IUPAC name is methyl (2S,3S,4R,5R,6S)-3-acetyloxy-6-[4-(hydroxymethyl)phenoxy]-4,5-dimethyloxane-2-carboxylate.
| Compound Name | methyl (2S,3S,4R,5R,6S)-3-acetyloxy-6-[4-(hydroxymethyl)phenoxy]-4,5-dimethyloxane-2-carboxylate |
|---|---|
| PubChem CID | 164980192 |
| Molecular Formula | C18H24O7 |
| Molecular Weight | 352.38 g/mol |
| Exact Mass | 352.15 |
| IUPAC Name | methyl (2S,3S,4R,5R,6S)-3-acetyloxy-6-[4-(hydroxymethyl)phenoxy]-4,5-dimethyloxane-2-carboxylate |
| SMILES | COC(=O)[C@H]1O[C@@H](Oc2ccc(CO)cc2)[C@H](C)[C@@H](C)[C@@H]1OC(C)=O |
| InChI | InChI=1S/C18H24O7/c1-10-11(2)18(24-14-7-5-13(9-19)6-8-14)25-16(17(21)22-4)15(10)23-12(3)20/h5-8,10-11,15-16,18-19H,9H2,1-4H3/t10-,11-,15+,16+,18-/m1/s1 |
| InChIKey | NURHATWBHGPDKI-QPGXDIKASA-N |
| XLogP | 1.66 |
| TPSA | 91.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.38 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |