C26H30NO11S+ — CID 135256953
methyl 3,4,5-triacetyloxy-6-[4-[(1-methoxypyridin-1-ium-2-yl)sulfanylmethyl]phenoxy]oxane-2-carboxylate (PubChem CID 135256953) has the molecular formula C26H30NO11S+ and a molecular weight of 564.59 g/mol. Its IUPAC name is methyl 3,4,5-triacetyloxy-6-[4-[(1-methoxypyridin-1-ium-2-yl)sulfanylmethyl]phenoxy]oxane-2-carboxylate.
| Compound Name | methyl 3,4,5-triacetyloxy-6-[4-[(1-methoxypyridin-1-ium-2-yl)sulfanylmethyl]phenoxy]oxane-2-carboxylate |
|---|---|
| PubChem CID | 135256953 |
| Molecular Formula | C26H30NO11S+ |
| Molecular Weight | 564.59 g/mol |
| Exact Mass | 564.15 |
| IUPAC Name | methyl 3,4,5-triacetyloxy-6-[4-[(1-methoxypyridin-1-ium-2-yl)sulfanylmethyl]phenoxy]oxane-2-carboxylate |
| SMILES | COC(=O)C1OC(Oc2ccc(CSc3cccc[n+]3OC)cc2)C(OC(C)=O)C(OC(C)=O)C1OC(C)=O |
| InChI | InChI=1S/C26H30NO11S/c1-15(28)34-21-22(35-16(2)29)24(36-17(3)30)26(38-23(21)25(31)32-4)37-19-11-9-18(10-12-19)14-39-20-8-6-7-13-27(20)33-5/h6-13,21-24,26H,14H2,1-5H3/q+1 |
| InChIKey | PSKHDJAVXOGYQZ-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 136.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.59 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|