C21H23ClO12 — CID 163660015
[(2R,3R,4R,5R,6R)-2,3,5-triacetyloxy-6-[4-(carbonochloridoyloxymethyl)phenoxy]oxan-4-yl] acetate (PubChem CID 163660015) has the molecular formula C21H23ClO12 and a molecular weight of 502.86 g/mol. Its IUPAC name is [(2R,3R,4R,5R,6R)-2,3,5-triacetyloxy-6-[4-(carbonochloridoyloxymethyl)phenoxy]oxan-4-yl] acetate.
| Compound Name | [(2R,3R,4R,5R,6R)-2,3,5-triacetyloxy-6-[4-(carbonochloridoyloxymethyl)phenoxy]oxan-4-yl] acetate |
|---|---|
| PubChem CID | 163660015 |
| Molecular Formula | C21H23ClO12 |
| Molecular Weight | 502.86 g/mol |
| Exact Mass | 502.09 |
| IUPAC Name | [(2R,3R,4R,5R,6R)-2,3,5-triacetyloxy-6-[4-(carbonochloridoyloxymethyl)phenoxy]oxan-4-yl] acetate |
| SMILES | CC(=O)O[C@H]1O[C@@H](Oc2ccc(COC(=O)Cl)cc2)[C@H](OC(C)=O)[C@@H](OC(C)=O)[C@H]1OC(C)=O |
| InChI | InChI=1S/C21H23ClO12/c1-10(23)29-16-17(30-11(2)24)19(32-13(4)26)34-20(18(16)31-12(3)25)33-15-7-5-14(6-8-15)9-28-21(22)27/h5-8,16-20H,9H2,1-4H3/t16-,17+,18+,19-,20+/m0/s1 |
| InChIKey | ITOYKRXRDUHGEJ-MFKWGIFDSA-N |
| XLogP | 1.98 |
| TPSA | 149.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.86 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'acid_halide', 'substructure': 'N/A'} |
|---|