C25H28N2O12 — CID 71027414
[4-[(2S,3S,5R)-3,4,5-triacetyloxy-6-(acetyloxymethyl)oxan-2-yl]oxyphenyl]methyl imidazole-1-carboxylate (PubChem CID 71027414) has the molecular formula C25H28N2O12 and a molecular weight of 548.50 g/mol. Its IUPAC name is [4-[(2S,3S,5R)-3,4,5-triacetyloxy-6-(acetyloxymethyl)oxan-2-yl]oxyphenyl]methyl imidazole-1-carboxylate.
| Compound Name | [4-[(2S,3S,5R)-3,4,5-triacetyloxy-6-(acetyloxymethyl)oxan-2-yl]oxyphenyl]methyl imidazole-1-carboxylate |
|---|---|
| PubChem CID | 71027414 |
| Molecular Formula | C25H28N2O12 |
| Molecular Weight | 548.50 g/mol |
| Exact Mass | 548.16 |
| IUPAC Name | [4-[(2S,3S,5R)-3,4,5-triacetyloxy-6-(acetyloxymethyl)oxan-2-yl]oxyphenyl]methyl imidazole-1-carboxylate |
| SMILES | CC(=O)OCC1O[C@@H](Oc2ccc(COC(=O)n3ccnc3)cc2)[C@@H](OC(C)=O)C(OC(C)=O)[C@@H]1OC(C)=O |
| InChI | InChI=1S/C25H28N2O12/c1-14(28)33-12-20-21(35-15(2)29)22(36-16(3)30)23(37-17(4)31)24(39-20)38-19-7-5-18(6-8-19)11-34-25(32)27-10-9-26-13-27/h5-10,13,20-24H,11-12H2,1-4H3/t20?,21-,22?,23+,24-/m1/s1 |
| InChIKey | CJOJIDATHYXKHY-VZAIETPKSA-N |
| XLogP | 1.53 |
| TPSA | 167.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.50 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|