C26H37ClN2O12 — CID 178065823
[(2R,3S,4S,5R,6S)-3,4,5-triacetyloxy-6-[4-[[methyl-[2-(methylamino)ethyl]carbamoyl]oxymethyl]phenoxy]oxan-2-yl]methyl acetate;hydrochloride (PubChem CID 178065823) has the molecular formula C26H37ClN2O12 and a molecular weight of 605.04 g/mol. Its IUPAC name is [(2R,3S,4S,5R,6S)-3,4,5-triacetyloxy-6-[4-[[methyl-[2-(methylamino)ethyl]carbamoyl]oxymethyl]phenoxy]oxan-2-yl]methyl acetate;hydrochloride.
| Compound Name | [(2R,3S,4S,5R,6S)-3,4,5-triacetyloxy-6-[4-[[methyl-[2-(methylamino)ethyl]carbamoyl]oxymethyl]phenoxy]oxan-2-yl]methyl acetate;hydrochloride |
|---|---|
| PubChem CID | 178065823 |
| Molecular Formula | C26H37ClN2O12 |
| Molecular Weight | 605.04 g/mol |
| Exact Mass | 604.20 |
| IUPAC Name | [(2R,3S,4S,5R,6S)-3,4,5-triacetyloxy-6-[4-[[methyl-[2-(methylamino)ethyl]carbamoyl]oxymethyl]phenoxy]oxan-2-yl]methyl acetate;hydrochloride |
| SMILES | CNCCN(C)C(=O)OCc1ccc(O[C@@H]2O[C@H](COC(C)=O)[C@H](OC(C)=O)[C@H](OC(C)=O)[C@H]2OC(C)=O)cc1.Cl |
| InChI | InChI=1S/C26H36N2O12.ClH/c1-15(29)34-14-21-22(36-16(2)30)23(37-17(3)31)24(38-18(4)32)25(40-21)39-20-9-7-19(8-10-20)13-35-26(33)28(6)12-11-27-5;/h7-10,21-25,27H,11-14H2,1-6H3;1H/t21-,22+,23+,24-,25-;/m1./s1 |
| InChIKey | YOHLQFWPYFDQCG-GYXULRMLSA-N |
| XLogP | 1.36 |
| TPSA | 165.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 605.04 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|