C18H21NO10 — CID 68679097
(2R,3R,4R,5S,6R)-3,4,5-triacetyloxy-6-(4-aminophenoxy)oxane-2-carboxylic acid (PubChem CID 68679097) has the molecular formula C18H21NO10 and a molecular weight of 411.36 g/mol. Its IUPAC name is (2R,3R,4R,5S,6R)-3,4,5-triacetyloxy-6-(4-aminophenoxy)oxane-2-carboxylic acid.
| Compound Name | (2R,3R,4R,5S,6R)-3,4,5-triacetyloxy-6-(4-aminophenoxy)oxane-2-carboxylic acid |
|---|---|
| PubChem CID | 68679097 |
| Molecular Formula | C18H21NO10 |
| Molecular Weight | 411.36 g/mol |
| Exact Mass | 411.12 |
| IUPAC Name | (2R,3R,4R,5S,6R)-3,4,5-triacetyloxy-6-(4-aminophenoxy)oxane-2-carboxylic acid |
| SMILES | CC(=O)O[C@H]1[C@H](OC(C)=O)[C@@H](Oc2ccc(N)cc2)O[C@@H](C(=O)O)[C@@H]1OC(C)=O |
| InChI | InChI=1S/C18H21NO10/c1-8(20)25-13-14(26-9(2)21)16(27-10(3)22)18(29-15(13)17(23)24)28-12-6-4-11(19)5-7-12/h4-7,13-16,18H,19H2,1-3H3,(H,23,24)/t13-,14-,15-,16+,18+/m1/s1 |
| InChIKey | GQQFKELKEYYAHC-JLOCXQCDSA-N |
| XLogP | 0.25 |
| TPSA | 160.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.36 |
| LogP ≤ 5 | 0.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|