C27H42O6 — CID 159331263
methyl (3S,4S,6S)-6-[4-[[(2R,4S,5S)-6-ethyl-3,4,5-trimethyloxan-2-yl]oxymethyl]phenoxy]-3,4,5-trimethyloxane-2-carboxylate (PubChem CID 159331263) has the molecular formula C27H42O6 and a molecular weight of 462.63 g/mol. Its IUPAC name is methyl (3S,4S,6S)-6-[4-[[(2R,4S,5S)-6-ethyl-3,4,5-trimethyloxan-2-yl]oxymethyl]phenoxy]-3,4,5-trimethyloxane-2-carboxylate.
| Compound Name | methyl (3S,4S,6S)-6-[4-[[(2R,4S,5S)-6-ethyl-3,4,5-trimethyloxan-2-yl]oxymethyl]phenoxy]-3,4,5-trimethyloxane-2-carboxylate |
|---|---|
| PubChem CID | 159331263 |
| Molecular Formula | C27H42O6 |
| Molecular Weight | 462.63 g/mol |
| Exact Mass | 462.30 |
| IUPAC Name | methyl (3S,4S,6S)-6-[4-[[(2R,4S,5S)-6-ethyl-3,4,5-trimethyloxan-2-yl]oxymethyl]phenoxy]-3,4,5-trimethyloxane-2-carboxylate |
| SMILES | CCC1O[C@@H](OCc2ccc(O[C@@H]3OC(C(=O)OC)[C@@H](C)[C@H](C)C3C)cc2)C(C)[C@@H](C)[C@@H]1C |
| InChI | InChI=1S/C27H42O6/c1-9-23-17(4)15(2)19(6)26(32-23)30-14-21-10-12-22(13-11-21)31-27-20(7)16(3)18(5)24(33-27)25(28)29-8/h10-13,15-20,23-24,26-27H,9,14H2,1-8H3/t15-,16-,17-,18-,19?,20?,23?,24?,26+,27+/m0/s1 |
| InChIKey | WRXYZTWOXQMZNI-MIAWTBHJSA-N |
| XLogP | 5.43 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.63 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |