C18H23IO6 — CID 90441559
[(2R,3R,4S,5S,6R)-5-acetyloxy-2-ethyl-6-(4-iodophenoxy)-3-methyloxan-4-yl] acetate (PubChem CID 90441559) has the molecular formula C18H23IO6 and a molecular weight of 462.28 g/mol. Its IUPAC name is [(2R,3R,4S,5S,6R)-5-acetyloxy-2-ethyl-6-(4-iodophenoxy)-3-methyloxan-4-yl] acetate.
| Compound Name | [(2R,3R,4S,5S,6R)-5-acetyloxy-2-ethyl-6-(4-iodophenoxy)-3-methyloxan-4-yl] acetate |
|---|---|
| PubChem CID | 90441559 |
| Molecular Formula | C18H23IO6 |
| Molecular Weight | 462.28 g/mol |
| Exact Mass | 462.05 |
| IUPAC Name | [(2R,3R,4S,5S,6R)-5-acetyloxy-2-ethyl-6-(4-iodophenoxy)-3-methyloxan-4-yl] acetate |
| SMILES | CC[C@H]1O[C@H](Oc2ccc(I)cc2)[C@@H](OC(C)=O)[C@@H](OC(C)=O)[C@@H]1C |
| InChI | InChI=1S/C18H23IO6/c1-5-15-10(2)16(22-11(3)20)17(23-12(4)21)18(25-15)24-14-8-6-13(19)7-9-14/h6-10,15-18H,5H2,1-4H3/t10-,15-,16+,17+,18+/m1/s1 |
| InChIKey | WPDFGKFQPIFKHS-OOEWDNHQSA-N |
| XLogP | 3.30 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.28 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|