C17H19IO8 — CID 76517783
[4,5-diacetyloxy-6-(4-iodophenoxy)oxan-3-yl] acetate (PubChem CID 76517783) has the molecular formula C17H19IO8 and a molecular weight of 478.24 g/mol. Its IUPAC name is [4,5-diacetyloxy-6-(4-iodophenoxy)oxan-3-yl] acetate.
| Compound Name | [4,5-diacetyloxy-6-(4-iodophenoxy)oxan-3-yl] acetate |
|---|---|
| PubChem CID | 76517783 |
| Molecular Formula | C17H19IO8 |
| Molecular Weight | 478.24 g/mol |
| Exact Mass | 478.01 |
| IUPAC Name | [4,5-diacetyloxy-6-(4-iodophenoxy)oxan-3-yl] acetate |
| SMILES | CC(=O)OC1COC(Oc2ccc(I)cc2)C(OC(C)=O)C1OC(C)=O |
| InChI | InChI=1S/C17H19IO8/c1-9(19)23-14-8-22-17(26-13-6-4-12(18)5-7-13)16(25-11(3)21)15(14)24-10(2)20/h4-7,14-17H,8H2,1-3H3 |
| InChIKey | ODDYORMDUHOQPF-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 97.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.24 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|