C19H23NO9 — CID 11101630
[(3R,4S,5R,6S)-6-(4-acetamidophenoxy)-4,5-diacetyloxyoxan-3-yl] acetate (PubChem CID 11101630) has the molecular formula C19H23NO9 and a molecular weight of 409.39 g/mol. Its IUPAC name is [(3R,4S,5R,6S)-6-(4-acetamidophenoxy)-4,5-diacetyloxyoxan-3-yl] acetate.
| Compound Name | [(3R,4S,5R,6S)-6-(4-acetamidophenoxy)-4,5-diacetyloxyoxan-3-yl] acetate |
|---|---|
| PubChem CID | 11101630 |
| Molecular Formula | C19H23NO9 |
| Molecular Weight | 409.39 g/mol |
| Exact Mass | 409.14 |
| IUPAC Name | [(3R,4S,5R,6S)-6-(4-acetamidophenoxy)-4,5-diacetyloxyoxan-3-yl] acetate |
| SMILES | CC(=O)Nc1ccc(O[C@@H]2OC[C@@H](OC(C)=O)[C@H](OC(C)=O)[C@H]2OC(C)=O)cc1 |
| InChI | InChI=1S/C19H23NO9/c1-10(21)20-14-5-7-15(8-6-14)29-19-18(28-13(4)24)17(27-12(3)23)16(9-25-19)26-11(2)22/h5-8,16-19H,9H2,1-4H3,(H,20,21)/t16-,17+,18-,19+/m1/s1 |
| InChIKey | HNSLLWSNUAXPFO-HCXYKTFWSA-N |
| XLogP | 1.18 |
| TPSA | 126.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.39 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|