C14H16O7 — CID 143849703
[4-formyloxy-5-(4-methoxyphenoxy)oxolan-3-yl] acetate (PubChem CID 143849703) has the molecular formula C14H16O7 and a molecular weight of 296.28 g/mol. Its IUPAC name is [4-formyloxy-5-(4-methoxyphenoxy)oxolan-3-yl] acetate.
| Compound Name | [4-formyloxy-5-(4-methoxyphenoxy)oxolan-3-yl] acetate |
|---|---|
| PubChem CID | 143849703 |
| Molecular Formula | C14H16O7 |
| Molecular Weight | 296.28 g/mol |
| Exact Mass | 296.09 |
| IUPAC Name | [4-formyloxy-5-(4-methoxyphenoxy)oxolan-3-yl] acetate |
| SMILES | COc1ccc(OC2OCC(OC(C)=O)C2OC=O)cc1 |
| InChI | InChI=1S/C14H16O7/c1-9(16)20-12-7-18-14(13(12)19-8-15)21-11-5-3-10(17-2)4-6-11/h3-6,8,12-14H,7H2,1-2H3 |
| InChIKey | MLRQGWXFELQCFZ-UHFFFAOYSA-N |
| XLogP | 0.90 |
| TPSA | 80.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.28 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|