C18H22O8 — CID 169100342
[(3R,4S,5S,6S)-4,5-diacetyloxy-6-(4-methoxyphenyl)oxan-3-yl] acetate (PubChem CID 169100342) has the molecular formula C18H22O8 and a molecular weight of 366.37 g/mol. Its IUPAC name is [(3R,4S,5S,6S)-4,5-diacetyloxy-6-(4-methoxyphenyl)oxan-3-yl] acetate.
| Compound Name | [(3R,4S,5S,6S)-4,5-diacetyloxy-6-(4-methoxyphenyl)oxan-3-yl] acetate |
|---|---|
| PubChem CID | 169100342 |
| Molecular Formula | C18H22O8 |
| Molecular Weight | 366.37 g/mol |
| Exact Mass | 366.13 |
| IUPAC Name | [(3R,4S,5S,6S)-4,5-diacetyloxy-6-(4-methoxyphenyl)oxan-3-yl] acetate |
| SMILES | COc1ccc([C@@H]2OC[C@@H](OC(C)=O)[C@H](OC(C)=O)[C@H]2OC(C)=O)cc1 |
| InChI | InChI=1S/C18H22O8/c1-10(19)24-15-9-23-16(13-5-7-14(22-4)8-6-13)18(26-12(3)21)17(15)25-11(2)20/h5-8,15-18H,9H2,1-4H3/t15-,16+,17+,18+/m1/s1 |
| InChIKey | GATGDAOVJOTZHF-OWSLCNJRSA-N |
| XLogP | 1.56 |
| TPSA | 97.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.37 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|