About ethane;[4-formyloxy-5-(4-methoxyphenoxy)oxolan-3-yl] acetate;(Z)-2-methoxyhex-2-ene
ethane;[4-formyloxy-5-(4-methoxyphenoxy)oxolan-3-yl] acetate;(Z)-2-methoxyhex-2-ene (PubChem CID 143849702) has the molecular formula C23H36O8
and a molecular weight of 440.53 g/mol. Its IUPAC name is ethane;[4-formyloxy-5-(4-methoxyphenoxy)oxolan-3-yl] acetate;(Z)-2-methoxyhex-2-ene.
Molecular Properties
| Compound Name | ethane;[4-formyloxy-5-(4-methoxyphenoxy)oxolan-3-yl] acetate;(Z)-2-methoxyhex-2-ene |
| PubChem CID | 143849702 |
| Molecular Formula | C23H36O8 |
| Molecular Weight | 440.53 g/mol |
| Exact Mass | 440.24 |
| IUPAC Name | ethane;[4-formyloxy-5-(4-methoxyphenoxy)oxolan-3-yl] acetate;(Z)-2-methoxyhex-2-ene |
| SMILES | CC.CCC/C=C(/C)OC.COc1ccc(OC2OCC(OC(C)=O)C2OC=O)cc1 |
| InChI | InChI=1S/C14H16O7.C7H14O.C2H6/c1-9(16)20-12-7-18-14(13(12)19-8-15)21-11-5-3-10(17-2)4-6-11;1-4-5-6-7(2)8-3;1-2/h3-6,8,12-14H,7H2,1-2H3;6H,4-5H2,1-3H3;1-2H3/b;7-6-; |
| InChIKey | PRHITSLTMZECLQ-IICHUWEQSA-N |
| XLogP | 4.27 |
| TPSA | 89.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 440.53 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze ethane;[4-formyloxy-5-(4-methoxyphenoxy)oxolan-3-yl] acetate;(Z)-2-methoxyhex-2-ene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;[4-formyloxy-5-(4-methoxyphenoxy)oxolan-3-yl] acetate;(Z)-2-methoxyhex-2-ene?
The IUPAC name of ethane;[4-formyloxy-5-(4-methoxyphenoxy)oxolan-3-yl] acetate;(Z)-2-methoxyhex-2-ene (CID 143849702) is ethane;[4-formyloxy-5-(4-methoxyphenoxy)oxolan-3-yl] acetate;(Z)-2-methoxyhex-2-ene.
What is the SMILES notation for ethane;[4-formyloxy-5-(4-methoxyphenoxy)oxolan-3-yl] acetate;(Z)-2-methoxyhex-2-ene?
The canonical SMILES for ethane;[4-formyloxy-5-(4-methoxyphenoxy)oxolan-3-yl] acetate;(Z)-2-methoxyhex-2-ene is CC.CCC/C=C(/C)OC.COc1ccc(OC2OCC(OC(C)=O)C2OC=O)cc1.
What is the InChIKey of ethane;[4-formyloxy-5-(4-methoxyphenoxy)oxolan-3-yl] acetate;(Z)-2-methoxyhex-2-ene?
The InChIKey is PRHITSLTMZECLQ-IICHUWEQSA-N. The full InChI is InChI=1S/C14H16O7.C7H14O.C2H6/c1-9(16)20-12-7-18-14(13(12)19-8-15)21-11-5-3-10(17-2)4-6-11;1-4-5-6-7(2)8-3;1-2/h3-6,8,12-14H,7H2,1-2H3;6H,4-5H2,1-3H3;1-2H3/b;7-6-;.
What are the key properties of ethane;[4-formyloxy-5-(4-methoxyphenoxy)oxolan-3-yl] acetate;(Z)-2-methoxyhex-2-ene?
ethane;[4-formyloxy-5-(4-methoxyphenoxy)oxolan-3-yl] acetate;(Z)-2-methoxyhex-2-ene has a molecular weight of 440.53 g/mol, XLogP of 4.27, 9 rotatable bonds, 0 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;[4-formyloxy-5-(4-methoxyphenoxy)oxolan-3-yl] acetate;(Z)-2-methoxyhex-2-ene is sourced from PubChem (CID 143849702), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).