C11H15BrO8 — CID 139488832
[(3R,4S,5R)-4,5-diacetyloxy-6-bromooxyoxan-3-yl] acetate (PubChem CID 139488832) has the molecular formula C11H15BrO8 and a molecular weight of 355.14 g/mol. Its IUPAC name is [(3R,4S,5R)-4,5-diacetyloxy-6-bromooxyoxan-3-yl] acetate.
| Compound Name | [(3R,4S,5R)-4,5-diacetyloxy-6-bromooxyoxan-3-yl] acetate |
|---|---|
| PubChem CID | 139488832 |
| Molecular Formula | C11H15BrO8 |
| Molecular Weight | 355.14 g/mol |
| Exact Mass | 354.00 |
| IUPAC Name | [(3R,4S,5R)-4,5-diacetyloxy-6-bromooxyoxan-3-yl] acetate |
| SMILES | CC(=O)O[C@H]1[C@H](OC(C)=O)COC(OBr)[C@@H]1OC(C)=O |
| InChI | InChI=1S/C11H15BrO8/c1-5(13)17-8-4-16-11(20-12)10(19-7(3)15)9(8)18-6(2)14/h8-11H,4H2,1-3H3/t8-,9+,10-,11?/m1/s1 |
| InChIKey | STZBFAQFRTXWQD-GZBOUJLJSA-N |
| XLogP | 0.46 |
| TPSA | 97.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.14 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|