C15H24O8 — CID 12997603
[(3R,4S,5R,6R)-4,5-diacetyloxy-6-butoxyoxan-3-yl] acetate (PubChem CID 12997603) has the molecular formula C15H24O8 and a molecular weight of 332.35 g/mol. Its IUPAC name is [(3R,4S,5R,6R)-4,5-diacetyloxy-6-butoxyoxan-3-yl] acetate.
| Compound Name | [(3R,4S,5R,6R)-4,5-diacetyloxy-6-butoxyoxan-3-yl] acetate |
|---|---|
| PubChem CID | 12997603 |
| Molecular Formula | C15H24O8 |
| Molecular Weight | 332.35 g/mol |
| Exact Mass | 332.15 |
| IUPAC Name | [(3R,4S,5R,6R)-4,5-diacetyloxy-6-butoxyoxan-3-yl] acetate |
| SMILES | CCCCO[C@@H]1OC[C@@H](OC(C)=O)[C@H](OC(C)=O)[C@H]1OC(C)=O |
| InChI | InChI=1S/C15H24O8/c1-5-6-7-19-15-14(23-11(4)18)13(22-10(3)17)12(8-20-15)21-9(2)16/h12-15H,5-8H2,1-4H3/t12-,13+,14-,15-/m1/s1 |
| InChIKey | OMOMUDIDHUJZPI-LXTVHRRPSA-N |
| XLogP | 0.95 |
| TPSA | 97.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.35 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|