C15H25NO8 — CID 156904605
[(3S,4S,5R)-4,5-diacetyloxy-6-(4-aminobutoxy)oxan-3-yl] acetate (PubChem CID 156904605) has the molecular formula C15H25NO8 and a molecular weight of 347.36 g/mol. Its IUPAC name is [(3S,4S,5R)-4,5-diacetyloxy-6-(4-aminobutoxy)oxan-3-yl] acetate.
| Compound Name | [(3S,4S,5R)-4,5-diacetyloxy-6-(4-aminobutoxy)oxan-3-yl] acetate |
|---|---|
| PubChem CID | 156904605 |
| Molecular Formula | C15H25NO8 |
| Molecular Weight | 347.36 g/mol |
| Exact Mass | 347.16 |
| IUPAC Name | [(3S,4S,5R)-4,5-diacetyloxy-6-(4-aminobutoxy)oxan-3-yl] acetate |
| SMILES | CC(=O)O[C@H]1[C@@H](OC(C)=O)COC(OCCCCN)[C@@H]1OC(C)=O |
| InChI | InChI=1S/C15H25NO8/c1-9(17)22-12-8-21-15(20-7-5-4-6-16)14(24-11(3)19)13(12)23-10(2)18/h12-15H,4-8,16H2,1-3H3/t12-,13-,14+,15?/m0/s1 |
| InChIKey | AFCINBYNLBVJOC-RDGKXADDSA-N |
| XLogP | -0.11 |
| TPSA | 123.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.36 |
| LogP ≤ 5 | -0.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|