C15H26BrNO8 — CID 156904604
4-[(3R,4S,5S)-3,4,5-triacetyloxyoxan-2-yl]oxybutylazanium bromide (PubChem CID 156904604) has the molecular formula C15H26BrNO8 and a molecular weight of 428.28 g/mol. Its IUPAC name is 4-[(3R,4S,5S)-3,4,5-triacetyloxyoxan-2-yl]oxybutylazanium bromide.
| Compound Name | 4-[(3R,4S,5S)-3,4,5-triacetyloxyoxan-2-yl]oxybutylazanium bromide |
|---|---|
| PubChem CID | 156904604 |
| Molecular Formula | C15H26BrNO8 |
| Molecular Weight | 428.28 g/mol |
| Exact Mass | 427.08 |
| IUPAC Name | 4-[(3R,4S,5S)-3,4,5-triacetyloxyoxan-2-yl]oxybutylazanium bromide |
| SMILES | CC(=O)O[C@H]1[C@@H](OC(C)=O)COC(OCCCC[NH3+])[C@@H]1OC(C)=O.[Br-] |
| InChI | InChI=1S/C15H25NO8.BrH/c1-9(17)22-12-8-21-15(20-7-5-4-6-16)14(24-11(3)19)13(12)23-10(2)18;/h12-15H,4-8,16H2,1-3H3;1H/t12-,13-,14+,15?;/m0./s1 |
| InChIKey | FTHDDZOFUOZJHK-IEMJURHMSA-N |
| XLogP | -3.82 |
| TPSA | 125.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.28 |
| LogP ≤ 5 | -3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|