C19H30NO8+ — CID 147600313
methyl-prop-2-ynyl-[4-(3,4,5-triacetyloxyoxan-2-yl)oxybutyl]azanium (PubChem CID 147600313) has the molecular formula C19H30NO8+ and a molecular weight of 400.45 g/mol. Its IUPAC name is methyl-prop-2-ynyl-[4-(3,4,5-triacetyloxyoxan-2-yl)oxybutyl]azanium.
| Compound Name | methyl-prop-2-ynyl-[4-(3,4,5-triacetyloxyoxan-2-yl)oxybutyl]azanium |
|---|---|
| PubChem CID | 147600313 |
| Molecular Formula | C19H30NO8+ |
| Molecular Weight | 400.45 g/mol |
| Exact Mass | 400.20 |
| IUPAC Name | methyl-prop-2-ynyl-[4-(3,4,5-triacetyloxyoxan-2-yl)oxybutyl]azanium |
| SMILES | C#CC[NH+](C)CCCCOC1OCC(OC(C)=O)C(OC(C)=O)C1OC(C)=O |
| InChI | InChI=1S/C19H29NO8/c1-6-9-20(5)10-7-8-11-24-19-18(28-15(4)23)17(27-14(3)22)16(12-25-19)26-13(2)21/h1,16-19H,7-12H2,2-5H3/p+1 |
| InChIKey | FZZVXFRRGAQWHU-UHFFFAOYSA-O |
| XLogP | -0.92 |
| TPSA | 101.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.45 |
| LogP ≤ 5 | -0.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|