C20H32NO8+ — CID 146629498
dimethyl-prop-2-ynyl-[4-[(3R,4S,5R)-3,4,5-triacetyloxyoxan-2-yl]oxybutyl]azanium (PubChem CID 146629498) has the molecular formula C20H32NO8+ and a molecular weight of 414.48 g/mol. Its IUPAC name is dimethyl-prop-2-ynyl-[4-[(3R,4S,5R)-3,4,5-triacetyloxyoxan-2-yl]oxybutyl]azanium.
| Compound Name | dimethyl-prop-2-ynyl-[4-[(3R,4S,5R)-3,4,5-triacetyloxyoxan-2-yl]oxybutyl]azanium |
|---|---|
| PubChem CID | 146629498 |
| Molecular Formula | C20H32NO8+ |
| Molecular Weight | 414.48 g/mol |
| Exact Mass | 414.21 |
| IUPAC Name | dimethyl-prop-2-ynyl-[4-[(3R,4S,5R)-3,4,5-triacetyloxyoxan-2-yl]oxybutyl]azanium |
| SMILES | C#CC[N+](C)(C)CCCCOC1OC[C@@H](OC(C)=O)[C@H](OC(C)=O)[C@H]1OC(C)=O |
| InChI | InChI=1S/C20H32NO8/c1-7-10-21(5,6)11-8-9-12-25-20-19(29-16(4)24)18(28-15(3)23)17(13-26-20)27-14(2)22/h1,17-20H,8-13H2,2-6H3/q+1/t17-,18+,19-,20?/m1/s1 |
| InChIKey | XVLVEMSSVGXXML-BMHONFFRSA-N |
| XLogP | 0.64 |
| TPSA | 97.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.48 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|