C14H24NO4+ — CID 146668938
2-(3-acetyloxyoxan-2-yl)oxyethyl-dimethyl-prop-2-ynylazanium (PubChem CID 146668938) has the molecular formula C14H24NO4+ and a molecular weight of 270.35 g/mol. Its IUPAC name is 2-(3-acetyloxyoxan-2-yl)oxyethyl-dimethyl-prop-2-ynylazanium.
| Compound Name | 2-(3-acetyloxyoxan-2-yl)oxyethyl-dimethyl-prop-2-ynylazanium |
|---|---|
| PubChem CID | 146668938 |
| Molecular Formula | C14H24NO4+ |
| Molecular Weight | 270.35 g/mol |
| Exact Mass | 270.17 |
| IUPAC Name | 2-(3-acetyloxyoxan-2-yl)oxyethyl-dimethyl-prop-2-ynylazanium |
| SMILES | C#CC[N+](C)(C)CCOC1OCCCC1OC(C)=O |
| InChI | InChI=1S/C14H24NO4/c1-5-8-15(3,4)9-11-18-14-13(19-12(2)16)7-6-10-17-14/h1,13-14H,6-11H2,2-4H3/q+1 |
| InChIKey | JIVYGRAHPVFPCK-UHFFFAOYSA-N |
| XLogP | 0.78 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.35 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|