C25H42INO8 — CID 146629272
dimethyl-prop-2-ynyl-[2-[(3S,4R,5R,6S)-3,4,5-tri(butanoyloxy)-6-methyloxan-2-yl]oxyethyl]azanium iodide (PubChem CID 146629272) has the molecular formula C25H42INO8 and a molecular weight of 611.51 g/mol. Its IUPAC name is dimethyl-prop-2-ynyl-[2-[(3S,4R,5R,6S)-3,4,5-tri(butanoyloxy)-6-methyloxan-2-yl]oxyethyl]azanium iodide.
| Compound Name | dimethyl-prop-2-ynyl-[2-[(3S,4R,5R,6S)-3,4,5-tri(butanoyloxy)-6-methyloxan-2-yl]oxyethyl]azanium iodide |
|---|---|
| PubChem CID | 146629272 |
| Molecular Formula | C25H42INO8 |
| Molecular Weight | 611.51 g/mol |
| Exact Mass | 611.20 |
| IUPAC Name | dimethyl-prop-2-ynyl-[2-[(3S,4R,5R,6S)-3,4,5-tri(butanoyloxy)-6-methyloxan-2-yl]oxyethyl]azanium iodide |
| SMILES | C#CC[N+](C)(C)CCOC1O[C@@H](C)[C@@H](OC(=O)CCC)[C@@H](OC(=O)CCC)[C@@H]1OC(=O)CCC.[I-] |
| InChI | InChI=1S/C25H42NO8.HI/c1-8-12-19(27)32-22-18(5)31-25(30-17-16-26(6,7)15-11-4)24(34-21(29)14-10-3)23(22)33-20(28)13-9-2;/h4,18,22-25H,8-10,12-17H2,1-3,5-7H3;1H/q+1;/p-1/t18-,22+,23+,24-,25?;/m0./s1 |
| InChIKey | SNNSREHQTAMWFT-CXTQHXKESA-M |
| XLogP | -0.40 |
| TPSA | 97.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 611.51 |
| LogP ≤ 5 | -0.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|