C18H28O9 — CID 137357329
[(2S,3R,4R,5S)-2-methyl-4,5,6-tri(propanoyloxy)oxan-3-yl] propanoate (PubChem CID 137357329) has the molecular formula C18H28O9 and a molecular weight of 388.41 g/mol. Its IUPAC name is [(2S,3R,4R,5S)-2-methyl-4,5,6-tri(propanoyloxy)oxan-3-yl] propanoate.
| Compound Name | [(2S,3R,4R,5S)-2-methyl-4,5,6-tri(propanoyloxy)oxan-3-yl] propanoate |
|---|---|
| PubChem CID | 137357329 |
| Molecular Formula | C18H28O9 |
| Molecular Weight | 388.41 g/mol |
| Exact Mass | 388.17 |
| IUPAC Name | [(2S,3R,4R,5S)-2-methyl-4,5,6-tri(propanoyloxy)oxan-3-yl] propanoate |
| SMILES | CCC(=O)OC1O[C@@H](C)[C@@H](OC(=O)CC)[C@@H](OC(=O)CC)[C@@H]1OC(=O)CC |
| InChI | InChI=1S/C18H28O9/c1-6-11(19)24-15-10(5)23-18(27-14(22)9-4)17(26-13(21)8-3)16(15)25-12(20)7-2/h10,15-18H,6-9H2,1-5H3/t10-,15+,16+,17-,18?/m0/s1 |
| InChIKey | DSJOGOWIKZNPFL-PMZGEXBGSA-N |
| XLogP | 1.65 |
| TPSA | 114.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.41 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|