C23H27NO10 — CID 153313047
[(2S,3R,4R,5S,6S)-6-(1,3-dioxoisoindol-2-yl)oxy-2-methyl-4,5-di(propanoyloxy)oxan-3-yl] propanoate (PubChem CID 153313047) has the molecular formula C23H27NO10 and a molecular weight of 477.47 g/mol. Its IUPAC name is [(2S,3R,4R,5S,6S)-6-(1,3-dioxoisoindol-2-yl)oxy-2-methyl-4,5-di(propanoyloxy)oxan-3-yl] propanoate.
| Compound Name | [(2S,3R,4R,5S,6S)-6-(1,3-dioxoisoindol-2-yl)oxy-2-methyl-4,5-di(propanoyloxy)oxan-3-yl] propanoate |
|---|---|
| PubChem CID | 153313047 |
| Molecular Formula | C23H27NO10 |
| Molecular Weight | 477.47 g/mol |
| Exact Mass | 477.16 |
| IUPAC Name | [(2S,3R,4R,5S,6S)-6-(1,3-dioxoisoindol-2-yl)oxy-2-methyl-4,5-di(propanoyloxy)oxan-3-yl] propanoate |
| SMILES | CCC(=O)O[C@H]1[C@H](OC(=O)CC)[C@H](ON2C(=O)c3ccccc3C2=O)O[C@@H](C)[C@H]1OC(=O)CC |
| InChI | InChI=1S/C23H27NO10/c1-5-15(25)31-18-12(4)30-23(20(33-17(27)7-3)19(18)32-16(26)6-2)34-24-21(28)13-10-8-9-11-14(13)22(24)29/h8-12,18-20,23H,5-7H2,1-4H3/t12-,18+,19+,20-,23-/m0/s1 |
| InChIKey | BIVXGPJWLZHRRF-KQXHHIROSA-N |
| XLogP | 1.92 |
| TPSA | 134.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.47 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|