C33H30O10 — CID 91523472
[(3R,4S,6S)-4,5-dibenzoyloxy-6-[[5-(hydroxymethyl)furan-2-yl]methoxy]-2-methyloxan-3-yl] benzoate (PubChem CID 91523472) has the molecular formula C33H30O10 and a molecular weight of 586.59 g/mol. Its IUPAC name is [(3R,4S,6S)-4,5-dibenzoyloxy-6-[[5-(hydroxymethyl)furan-2-yl]methoxy]-2-methyloxan-3-yl] benzoate.
| Compound Name | [(3R,4S,6S)-4,5-dibenzoyloxy-6-[[5-(hydroxymethyl)furan-2-yl]methoxy]-2-methyloxan-3-yl] benzoate |
|---|---|
| PubChem CID | 91523472 |
| Molecular Formula | C33H30O10 |
| Molecular Weight | 586.59 g/mol |
| Exact Mass | 586.18 |
| IUPAC Name | [(3R,4S,6S)-4,5-dibenzoyloxy-6-[[5-(hydroxymethyl)furan-2-yl]methoxy]-2-methyloxan-3-yl] benzoate |
| SMILES | CC1O[C@H](OCc2ccc(CO)o2)C(OC(=O)c2ccccc2)[C@@H](OC(=O)c2ccccc2)[C@@H]1OC(=O)c1ccccc1 |
| InChI | InChI=1S/C33H30O10/c1-21-27(41-30(35)22-11-5-2-6-12-22)28(42-31(36)23-13-7-3-8-14-23)29(43-32(37)24-15-9-4-10-16-24)33(39-21)38-20-26-18-17-25(19-34)40-26/h2-18,21,27-29,33-34H,19-20H2,1H3/t21?,27-,28+,29?,33+/m1/s1 |
| InChIKey | VYHFOMKZNDRUHU-KTLJYVDVSA-N |
| XLogP | 4.71 |
| TPSA | 130.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.59 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|