C26H36O17 — CID 133126447
[(3S,6R)-4,5-diacetyloxy-2-methyl-6-[[(3R,6S)-3,4,5,6-tetraacetyloxyoxan-2-yl]methoxy]oxan-3-yl] acetate (PubChem CID 133126447) has the molecular formula C26H36O17 and a molecular weight of 620.56 g/mol. Its IUPAC name is [(3S,6R)-4,5-diacetyloxy-2-methyl-6-[[(3R,6S)-3,4,5,6-tetraacetyloxyoxan-2-yl]methoxy]oxan-3-yl] acetate.
| Compound Name | [(3S,6R)-4,5-diacetyloxy-2-methyl-6-[[(3R,6S)-3,4,5,6-tetraacetyloxyoxan-2-yl]methoxy]oxan-3-yl] acetate |
|---|---|
| PubChem CID | 133126447 |
| Molecular Formula | C26H36O17 |
| Molecular Weight | 620.56 g/mol |
| Exact Mass | 620.20 |
| IUPAC Name | [(3S,6R)-4,5-diacetyloxy-2-methyl-6-[[(3R,6S)-3,4,5,6-tetraacetyloxyoxan-2-yl]methoxy]oxan-3-yl] acetate |
| SMILES | CC(=O)OC1C(OC(C)=O)[C@H](OC(C)=O)C(CO[C@@H]2OC(C)[C@H](OC(C)=O)C(OC(C)=O)C2OC(C)=O)O[C@H]1OC(C)=O |
| InChI | InChI=1S/C26H36O17/c1-10-19(36-11(2)27)21(38-13(4)29)23(40-15(6)31)25(35-10)34-9-18-20(37-12(3)28)22(39-14(5)30)24(41-16(7)32)26(43-18)42-17(8)33/h10,18-26H,9H2,1-8H3/t10?,18?,19-,20+,21?,22?,23?,24?,25+,26+/m0/s1 |
| InChIKey | LUCVIXHBPBCYCD-UCSKBPCWSA-N |
| XLogP | -0.37 |
| TPSA | 211.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 17 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 620.56 |
| LogP ≤ 5 | -0.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 17 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|