C22H38O7 — CID 162770812
[4,5-di(butanoyloxy)-6-tert-butyl-2-methyloxan-3-yl] butanoate (PubChem CID 162770812) has the molecular formula C22H38O7 and a molecular weight of 414.54 g/mol. Its IUPAC name is [4,5-di(butanoyloxy)-6-tert-butyl-2-methyloxan-3-yl] butanoate.
| Compound Name | [4,5-di(butanoyloxy)-6-tert-butyl-2-methyloxan-3-yl] butanoate |
|---|---|
| PubChem CID | 162770812 |
| Molecular Formula | C22H38O7 |
| Molecular Weight | 414.54 g/mol |
| Exact Mass | 414.26 |
| IUPAC Name | [4,5-di(butanoyloxy)-6-tert-butyl-2-methyloxan-3-yl] butanoate |
| SMILES | CCCC(=O)OC1C(C)OC(C(C)(C)C)C(OC(=O)CCC)C1OC(=O)CCC |
| InChI | InChI=1S/C22H38O7/c1-8-11-15(23)27-18-14(4)26-21(22(5,6)7)20(29-17(25)13-10-3)19(18)28-16(24)12-9-2/h14,18-21H,8-13H2,1-7H3 |
| InChIKey | SBKRQMRVLMWMCW-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 88.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.54 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|