C25H36O10 — CID 153373232
2-[(2S,3S,4R,5R,6S)-4,5-di(butanoyloxy)-3-(1-hydroxybutoxy)-6-methyloxan-2-yl]oxybenzoic acid (PubChem CID 153373232) has the molecular formula C25H36O10 and a molecular weight of 496.55 g/mol. Its IUPAC name is 2-[(2S,3S,4R,5R,6S)-4,5-di(butanoyloxy)-3-(1-hydroxybutoxy)-6-methyloxan-2-yl]oxybenzoic acid.
| Compound Name | 2-[(2S,3S,4R,5R,6S)-4,5-di(butanoyloxy)-3-(1-hydroxybutoxy)-6-methyloxan-2-yl]oxybenzoic acid |
|---|---|
| PubChem CID | 153373232 |
| Molecular Formula | C25H36O10 |
| Molecular Weight | 496.55 g/mol |
| Exact Mass | 496.23 |
| IUPAC Name | 2-[(2S,3S,4R,5R,6S)-4,5-di(butanoyloxy)-3-(1-hydroxybutoxy)-6-methyloxan-2-yl]oxybenzoic acid |
| SMILES | CCCC(=O)O[C@H]1[C@H](OC(O)CCC)[C@H](Oc2ccccc2C(=O)O)O[C@@H](C)[C@H]1OC(=O)CCC |
| InChI | InChI=1S/C25H36O10/c1-5-10-18(26)33-21-15(4)31-25(32-17-14-9-8-13-16(17)24(29)30)23(35-20(28)12-7-3)22(21)34-19(27)11-6-2/h8-9,13-15,20-23,25,28H,5-7,10-12H2,1-4H3,(H,29,30)/t15-,20?,21+,22+,23-,25-/m0/s1 |
| InChIKey | ICQIEKRXJFZJNX-POKIIZERSA-N |
| XLogP | 3.44 |
| TPSA | 137.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.55 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|