C28H36O8 — CID 11755710
[(1R,2R,3S,4S,5R,6S)-2-butanoyloxy-4,5-dihydroxy-3,6-bis(phenylmethoxy)cyclohexyl] butanoate (PubChem CID 11755710) has the molecular formula C28H36O8 and a molecular weight of 500.59 g/mol. Its IUPAC name is [(1R,2R,3S,4S,5R,6S)-2-butanoyloxy-4,5-dihydroxy-3,6-bis(phenylmethoxy)cyclohexyl] butanoate.
| Compound Name | [(1R,2R,3S,4S,5R,6S)-2-butanoyloxy-4,5-dihydroxy-3,6-bis(phenylmethoxy)cyclohexyl] butanoate |
|---|---|
| PubChem CID | 11755710 |
| Molecular Formula | C28H36O8 |
| Molecular Weight | 500.59 g/mol |
| Exact Mass | 500.24 |
| IUPAC Name | [(1R,2R,3S,4S,5R,6S)-2-butanoyloxy-4,5-dihydroxy-3,6-bis(phenylmethoxy)cyclohexyl] butanoate |
| SMILES | CCCC(=O)O[C@H]1[C@H](OC(=O)CCC)[C@@H](OCc2ccccc2)[C@@H](O)[C@@H](O)[C@@H]1OCc1ccccc1 |
| InChI | InChI=1S/C28H36O8/c1-3-11-21(29)35-27-25(33-17-19-13-7-5-8-14-19)23(31)24(32)26(28(27)36-22(30)12-4-2)34-18-20-15-9-6-10-16-20/h5-10,13-16,23-28,31-32H,3-4,11-12,17-18H2,1-2H3/t23-,24+,25-,26-,27+,28+/m0/s1 |
| InChIKey | PONAFNBYLHRCLQ-MUJQFDPKSA-N |
| XLogP | 3.32 |
| TPSA | 111.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.59 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |