C18H24O3 — CID 23256435
[(1S,2S,4R)-7-phenylmethoxy-2-bicyclo[2.2.1]heptanyl] butanoate (PubChem CID 23256435) has the molecular formula C18H24O3 and a molecular weight of 288.39 g/mol. Its IUPAC name is [(1S,2S,4R)-7-phenylmethoxy-2-bicyclo[2.2.1]heptanyl] butanoate.
| Compound Name | [(1S,2S,4R)-7-phenylmethoxy-2-bicyclo[2.2.1]heptanyl] butanoate |
|---|---|
| PubChem CID | 23256435 |
| Molecular Formula | C18H24O3 |
| Molecular Weight | 288.39 g/mol |
| Exact Mass | 288.17 |
| IUPAC Name | [(1S,2S,4R)-7-phenylmethoxy-2-bicyclo[2.2.1]heptanyl] butanoate |
| SMILES | CCCC(=O)O[C@H]1C[C@H]2CC[C@@H]1C2OCc1ccccc1 |
| InChI | InChI=1S/C18H24O3/c1-2-6-17(19)21-16-11-14-9-10-15(16)18(14)20-12-13-7-4-3-5-8-13/h3-5,7-8,14-16,18H,2,6,9-12H2,1H3/t14-,15+,16+,18?/m1/s1 |
| InChIKey | SZBCDYQTCGWDQB-PGQZYJQNSA-N |
| XLogP | 3.71 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.39 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |