C18H27NO2 — CID 91414149
[4-[(benzylamino)methyl]cyclohexyl] butanoate (PubChem CID 91414149) has the molecular formula C18H27NO2 and a molecular weight of 289.42 g/mol. Its IUPAC name is [4-[(benzylamino)methyl]cyclohexyl] butanoate.
| Compound Name | [4-[(benzylamino)methyl]cyclohexyl] butanoate |
|---|---|
| PubChem CID | 91414149 |
| Molecular Formula | C18H27NO2 |
| Molecular Weight | 289.42 g/mol |
| Exact Mass | 289.20 |
| IUPAC Name | [4-[(benzylamino)methyl]cyclohexyl] butanoate |
| SMILES | CCCC(=O)OC1CCC(CNCc2ccccc2)CC1 |
| InChI | InChI=1S/C18H27NO2/c1-2-6-18(20)21-17-11-9-16(10-12-17)14-19-13-15-7-4-3-5-8-15/h3-5,7-8,16-17,19H,2,6,9-14H2,1H3 |
| InChIKey | UNHTWSKZTBQZMT-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.42 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |