C22H28FNO2S — CID 143767157
4-[[(4-fluorophenyl)methylamino]methyl]cyclohexane-1-carboxylic acid;phenylmethanethiol (PubChem CID 143767157) has the molecular formula C22H28FNO2S and a molecular weight of 389.54 g/mol. Its IUPAC name is 4-[[(4-fluorophenyl)methylamino]methyl]cyclohexane-1-carboxylic acid;phenylmethanethiol.
| Compound Name | 4-[[(4-fluorophenyl)methylamino]methyl]cyclohexane-1-carboxylic acid;phenylmethanethiol |
|---|---|
| PubChem CID | 143767157 |
| Molecular Formula | C22H28FNO2S |
| Molecular Weight | 389.54 g/mol |
| Exact Mass | 389.18 |
| IUPAC Name | 4-[[(4-fluorophenyl)methylamino]methyl]cyclohexane-1-carboxylic acid;phenylmethanethiol |
| SMILES | O=C(O)C1CCC(CNCc2ccc(F)cc2)CC1.SCc1ccccc1 |
| InChI | InChI=1S/C15H20FNO2.C7H8S/c16-14-7-3-12(4-8-14)10-17-9-11-1-5-13(6-2-11)15(18)19;8-6-7-4-2-1-3-5-7/h3-4,7-8,11,13,17H,1-2,5-6,9-10H2,(H,18,19);1-5,8H,6H2 |
| InChIKey | KAMGIOWYAUJTAS-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.54 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|