C16H22FNO3 — CID 104792773
4-[[(2-fluoro-3-methoxyphenyl)methylamino]methyl]cyclohexane-1-carboxylic acid (PubChem CID 104792773) has the molecular formula C16H22FNO3 and a molecular weight of 295.35 g/mol. Its IUPAC name is 4-[[(2-fluoro-3-methoxyphenyl)methylamino]methyl]cyclohexane-1-carboxylic acid.
| Compound Name | 4-[[(2-fluoro-3-methoxyphenyl)methylamino]methyl]cyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 104792773 |
| Molecular Formula | C16H22FNO3 |
| Molecular Weight | 295.35 g/mol |
| Exact Mass | 295.16 |
| IUPAC Name | 4-[[(2-fluoro-3-methoxyphenyl)methylamino]methyl]cyclohexane-1-carboxylic acid |
| SMILES | COc1cccc(CNCC2CCC(C(=O)O)CC2)c1F |
| InChI | InChI=1S/C16H22FNO3/c1-21-14-4-2-3-13(15(14)17)10-18-9-11-5-7-12(8-6-11)16(19)20/h2-4,11-12,18H,5-10H2,1H3,(H,19,20) |
| InChIKey | STPYQFPTPFVRME-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.35 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |