C15H20FNO2 — CID 5005578
4-[[(4-fluorophenyl)methylamino]methyl]cyclohexane-1-carboxylic acid (PubChem CID 5005578) has the molecular formula C15H20FNO2 and a molecular weight of 265.33 g/mol. Its IUPAC name is 4-[[(4-fluorophenyl)methylamino]methyl]cyclohexane-1-carboxylic acid.
| Compound Name | 4-[[(4-fluorophenyl)methylamino]methyl]cyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 5005578 |
| Molecular Formula | C15H20FNO2 |
| Molecular Weight | 265.33 g/mol |
| Exact Mass | 265.15 |
| IUPAC Name | 4-[[(4-fluorophenyl)methylamino]methyl]cyclohexane-1-carboxylic acid |
| SMILES | O=C(O)C1CCC(CNCc2ccc(F)cc2)CC1 |
| InChI | InChI=1S/C15H20FNO2/c16-14-7-3-12(4-8-14)10-17-9-11-1-5-13(6-2-11)15(18)19/h3-4,7-8,11,13,17H,1-2,5-6,9-10H2,(H,18,19) |
| InChIKey | BOGMGZWIRREMBI-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.33 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |