C16H21F2NO2 — CID 104964098
4-[[[3-(difluoromethyl)phenyl]methylamino]methyl]cyclohexane-1-carboxylic acid (PubChem CID 104964098) has the molecular formula C16H21F2NO2 and a molecular weight of 297.34 g/mol. Its IUPAC name is 4-[[[3-(difluoromethyl)phenyl]methylamino]methyl]cyclohexane-1-carboxylic acid.
| Compound Name | 4-[[[3-(difluoromethyl)phenyl]methylamino]methyl]cyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 104964098 |
| Molecular Formula | C16H21F2NO2 |
| Molecular Weight | 297.34 g/mol |
| Exact Mass | 297.15 |
| IUPAC Name | 4-[[[3-(difluoromethyl)phenyl]methylamino]methyl]cyclohexane-1-carboxylic acid |
| SMILES | O=C(O)C1CCC(CNCc2cccc(C(F)F)c2)CC1 |
| InChI | InChI=1S/C16H21F2NO2/c17-15(18)14-3-1-2-12(8-14)10-19-9-11-4-6-13(7-5-11)16(20)21/h1-3,8,11,13,15,19H,4-7,9-10H2,(H,20,21) |
| InChIKey | YMFUIKHJLRIJSH-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.34 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |